EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22N2O3 |
| Net Charge | 0 |
| Average Mass | 266.341 |
| Monoisotopic Mass | 266.16304 |
| SMILES | CC(=O)Nc1ccc(OCC(O)CNC(C)C)cc1 |
| InChI | InChI=1S/C14H22N2O3/c1-10(2)15-8-13(18)9-19-14-6-4-12(5-7-14)16-11(3)17/h4-7,10,13,15,18H,8-9H2,1-3H3,(H,16,17) |
| InChIKey | DURULFYMVIFBIR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| Applications: | beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| practolol (CHEBI:258351) has role anti-arrhythmia drug (CHEBI:38070) |
| practolol (CHEBI:258351) has role β-adrenergic antagonist (CHEBI:35530) |
| practolol (CHEBI:258351) is a acetamides (CHEBI:22160) |
| practolol (CHEBI:258351) is a ethanolamines (CHEBI:23981) |
| practolol (CHEBI:258351) is a propanolamine (CHEBI:35533) |
| practolol (CHEBI:258351) is a secondary alcohol (CHEBI:35681) |
| practolol (CHEBI:258351) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N-{4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}acetamide |
| INNs | Source |
|---|---|
| practolol | ChemIDplus |
| practololum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(4-acetamidophenoxy)-3-isopropylamino-2-propanol | ChemIDplus |
| 4'-(2-hydroxy-3-(isopropylamino)propoxy)acetanilide | ChemIDplus |
| N-(4-(2-hydroxy-3-((1-methylethyl)amino)propoxy)phenyl)acetamide | ChemIDplus |
| (±)-practolol | ChEBI |
| Citations |
|---|