EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N2O9 |
| Net Charge | 0 |
| Average Mass | 460.439 |
| Monoisotopic Mass | 460.14818 |
| SMILES | [H][C@@]12[C@@H](O)[C@@]3([H])C(=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@H]2N(C)C)C(=O)c1c(O)cccc1[C@@]3(C)O |
| InChI | InChI=1S/C22H24N2O9/c1-21(32)7-5-4-6-8(25)9(7)15(26)10-12(21)17(28)13-14(24(2)3)16(27)11(20(23)31)19(30)22(13,33)18(10)29/h4-6,12-14,17,25,27-29,32-33H,1-3H3,(H2,23,31)/t12-,13-,14+,17+,21-,22+/m1/s1 |
| InChIKey | IWVCMVBTMGNXQD-PXOLEDIWSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces rimosus (ncbitaxon:1927) | - | PubMed (1833366) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxytetracycline (CHEBI:27701) has role anti-inflammatory drug (CHEBI:35472) |
| oxytetracycline (CHEBI:27701) has role antibacterial drug (CHEBI:36047) |
| oxytetracycline (CHEBI:27701) has role antimicrobial agent (CHEBI:33281) |
| oxytetracycline (CHEBI:27701) has role bacterial metabolite (CHEBI:76969) |
| oxytetracycline (CHEBI:27701) has role protein synthesis inhibitor (CHEBI:48001) |
| oxytetracycline (CHEBI:27701) is a tetracyclines (CHEBI:26895) |
| oxytetracycline (CHEBI:27701) is tautomer of oxytetracycline zwitterion (CHEBI:133011) |
| Incoming Relation(s) |
| oxytetracycline zwitterion (CHEBI:133011) is tautomer of oxytetracycline (CHEBI:27701) |
| IUPAC Name |
|---|
| (4S,4aR,5S,5aR,6S,12aS)-4-(dimethylamino)-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
| INNs | Source |
|---|---|
| oxitetraciclina | ChemIDplus |
| oxytetracyclinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-Hydroxytetracycline | ChemIDplus |
| Oxyterracin | ChemIDplus |
| Oxyterracine | ChemIDplus |
| Oxytetracyclin | ChemIDplus |
| Oxytetracycline amphoteric | ChemIDplus |
| Oxytetracycline (anhydrous) | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2041 | DrugCentral |
| 503 | VSDB |
| 503 | BPDB |
| C00017127 | KNApSAcK |
| C06624 | KEGG COMPOUND |
| DB00595 | DrugBank |
| HMDB0014733 | HMDB |
| LMPK07000005 | LIPID MAPS |
| oxytetracycline | Alan Wood's Pesticides |
| Oxytetracycline | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2686362 | Beilstein |
| Reaxys:2714587 | Reaxys |
| Gmelin:623487 | Gmelin |
| CAS:79-57-2 | KEGG COMPOUND |
| CAS:79-57-2 | ChemIDplus |
| Citations |
|---|