EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8O4 |
| Net Charge | 0 |
| Average Mass | 240.214 |
| Monoisotopic Mass | 240.04226 |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc(O)c2O |
| InChI | InChI=1S/C14H8O4/c15-10-6-5-9-11(14(10)18)13(17)8-4-2-1-3-7(8)12(9)16/h1-6,15,18H |
| InChIKey | RGCKGOZRHPZPFP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | chromophore The part (atom or group of atoms) of a molecular entity in which the electronic transition responsible for a given spectral band is approximately localized. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alizarin (CHEBI:16866) has role chromophore (CHEBI:23240) |
| alizarin (CHEBI:16866) has role dye (CHEBI:37958) |
| alizarin (CHEBI:16866) has role plant metabolite (CHEBI:76924) |
| alizarin (CHEBI:16866) is a dihydroxyanthraquinone (CHEBI:37484) |
| Incoming Relation(s) |
| 1-hydroxy-2-(β-D-glucosyloxy)-9,10-anthraquinone (CHEBI:17770) has functional parent alizarin (CHEBI:16866) |
| IUPAC Name |
|---|
| 1,2-dihydroxyanthracene-9,10-dione |
| Synonyms | Source |
|---|---|
| 1,2-Anthraquinonediol | ChemIDplus |
| 1,2-dihydroxy-9,10-anthraquinone | IUPAC |
| 1,2-dihydroxyanthra-9,10-quinone | NIST Chemistry WebBook |
| 1,2-Dihydroxyanthraquinone | KEGG COMPOUND |
| Alizarin | KEGG COMPOUND |
| Alizarin B | ChemIDplus |
| UniProt Name | Source |
|---|---|
| alizarin | UniProt |
| Citations |
|---|