EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N2O8 |
| Net Charge | 0 |
| Average Mass | 288.212 |
| Monoisotopic Mass | 288.05937 |
| SMILES | O=C(O)c1cc(=O)nc(=O)n1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H12N2O8/c13-2-4-6(15)7(16)8(20-4)12-3(9(17)18)1-5(14)11-10(12)19/h1,4,6-8,13,15-16H,2H2,(H,17,18)(H,11,14,19)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | FKCRAVPPBFWEJD-XVFCMESISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orotidine (CHEBI:25722) has role bacterial metabolite (CHEBI:76969) |
| orotidine (CHEBI:25722) has role fungal metabolite (CHEBI:76946) |
| orotidine (CHEBI:25722) has role plant metabolite (CHEBI:76924) |
| orotidine (CHEBI:25722) is a nucleoside (CHEBI:33838) |
| orotidine (CHEBI:25722) is a pyrimidinemonocarboxylic acid (CHEBI:26447) |
| orotidine (CHEBI:25722) is a uridines (CHEBI:27242) |
| Synonyms | Source |
|---|---|
| 3-Ribofuranosylorotic acid | ChemIDplus |
| 6-Carboxyuridine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:47461 | Reaxys |
| CAS:314-50-1 | ChemIDplus |
| Citations |
|---|