EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32N6O3 |
| Net Charge | 0 |
| Average Mass | 416.526 |
| Monoisotopic Mass | 416.25359 |
| SMILES | CCC(=O)N(c1ccccc1)C1(COC)CCN(CCn2nnn(CC)c2=O)CC1 |
| InChI | InChI=1S/C21H32N6O3/c1-4-19(28)27(18-9-7-6-8-10-18)21(17-30-3)11-13-24(14-12-21)15-16-26-20(29)25(5-2)22-23-26/h6-10H,4-5,11-17H2,1-3H3 |
| InChIKey | IDBPHNDTYPBSNI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alfentanil (CHEBI:2569) has role central nervous system depressant (CHEBI:35488) |
| alfentanil (CHEBI:2569) has role intravenous anaesthetic (CHEBI:38877) |
| alfentanil (CHEBI:2569) has role opioid analgesic (CHEBI:35482) |
| alfentanil (CHEBI:2569) has role peripheral nervous system drug (CHEBI:49110) |
| alfentanil (CHEBI:2569) has role μ-opioid receptor agonist (CHEBI:55322) |
| alfentanil (CHEBI:2569) is a anilide (CHEBI:13248) |
| alfentanil (CHEBI:2569) is a ether (CHEBI:25698) |
| alfentanil (CHEBI:2569) is a monocarboxylic acid amide (CHEBI:29347) |
| alfentanil (CHEBI:2569) is a piperidines (CHEBI:26151) |
| alfentanil (CHEBI:2569) is a tertiary amino compound (CHEBI:50996) |
| alfentanil (CHEBI:2569) is a tetrazoles (CHEBI:35689) |
| IUPAC Name |
|---|
| N-{1-[2-(4-ethyl-5-oxo-4,5-dihydro-1H-tetrazol-1-yl)ethyl]-4-(methoxymethyl)piperidin-4-yl}-N-phenylpropanamide |
| INNs | Source |
|---|---|
| alfentanil | KEGG DRUG |
| alfentanilum | DrugBank |
| Synonyms | Source |
|---|---|
| Alfentanyl | DrugBank |
| N-(1-(2-(4-Ethyl-5-oxo-2-tetrazolin-1-yl)ethyl)-4-(methoxymethyl)-4-piperidyl)propionanilide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 114 | DrugCentral |
| Alfentanil | Wikipedia |
| C08005 | KEGG COMPOUND |
| D07122 | KEGG DRUG |
| DB00802 | DrugBank |
| DE2819873 | Patent |
| HMDB0014940 | HMDB |
| US2014005223 | Patent |
| US4167574 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1188293 | Reaxys |
| CAS:71195-58-9 | KEGG DRUG |
| CAS:71195-58-9 | KEGG COMPOUND |
| CAS:71195-58-9 | ChemIDplus |
| Citations |
|---|