EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H13NO7P2 |
| Net Charge | 0 |
| Average Mass | 249.096 |
| Monoisotopic Mass | 249.01673 |
| SMILES | NCCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C4H13NO7P2/c5-3-1-2-4(6,13(7,8)9)14(10,11)12/h6H,1-3,5H2,(H2,7,8,9)(H2,10,11,12) |
| InChIKey | OGSPWJRAVKPPFI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.5.1.1 (dimethylallyltranstransferase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of dimethylallyltranstransferase (EC 2.5.1.1). |
| Application: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alendronic acid (CHEBI:2567) has role bone density conservation agent (CHEBI:50646) |
| alendronic acid (CHEBI:2567) has role EC 2.5.1.1 (dimethylallyltranstransferase) inhibitor (CHEBI:50643) |
| alendronic acid (CHEBI:2567) is a 1,1-bis(phosphonic acid) (CHEBI:77383) |
| alendronic acid (CHEBI:2567) is a primary amino compound (CHEBI:50994) |
| alendronic acid (CHEBI:2567) is conjugate acid of alendronate(1-) (CHEBI:50647) |
| Incoming Relation(s) |
| alendronate(1-) (CHEBI:50647) is conjugate base of alendronic acid (CHEBI:2567) |
| IUPAC Name |
|---|
| (4-amino-1-hydroxybutane-1,1-diyl)bis(phosphonic acid) |
| INNs | Source |
|---|---|
| acide alendronique | ChemIDplus |
| ácido alendrónico | ChemIDplus |
| acidum alendronicum | ChemIDplus |
| alendronic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| (4-Amino-1-hydroxybutylidene)bisphosphonic acid | KEGG COMPOUND |
| Alendronate | KEGG COMPOUND |
| Alendronic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 112 | DrugCentral |
| AHD | PDBeChem |
| ALENDRONATE | MetaCyc |
| Alendronic_acid | Wikipedia |
| BE903519 | Patent |
| C07752 | KEGG COMPOUND |
| D07119 | KEGG DRUG |
| DB00630 | DrugBank |
| HMDB0001915 | HMDB |
| LSM-5831 | LINCS |
| US4705651 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2275403 | Reaxys |
| CAS:66376-36-1 | ChemIDplus |
| Citations |
|---|