EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO3 |
| Net Charge | 0 |
| Average Mass | 153.137 |
| Monoisotopic Mass | 153.04259 |
| SMILES | O=C(O)c1ccccc1NO |
| InChI | InChI=1S/C7H7NO3/c9-7(10)5-3-1-2-4-6(5)8-11/h1-4,8,11H,(H,9,10) |
| InChIKey | JKRIWPXSEMPTNP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxylaminobenzoic acid (CHEBI:25618) has role bacterial metabolite (CHEBI:76969) |
| 2-hydroxylaminobenzoic acid (CHEBI:25618) is a aminobenzoic acid (CHEBI:22495) |
| 2-hydroxylaminobenzoic acid (CHEBI:25618) is a hydroxylamines (CHEBI:24709) |
| IUPAC Name |
|---|
| 2-(hydroxyamino)benzoic acid |
| Synonyms | Source |
|---|---|
| N-(2-carboxyphenyl)hydroxylamine | ChEBI |
| N-hydroxy-anthranilic acid | ChEBI |
| o-Hydroxylaminobenzoate | KEGG COMPOUND |
| Citations |
|---|