EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16NO8 |
| Net Charge | -1 |
| Average Mass | 266.226 |
| Monoisotopic Mass | 266.08814 |
| SMILES | N[C@@H]([C@@H](O)[C@H](O)[C@H](O)CO)[C@@H](O)CC(=O)C(=O)[O-] |
| InChI | InChI=1S/C9H17NO8/c10-6(3(12)1-4(13)9(17)18)8(16)7(15)5(14)2-11/h3,5-8,11-12,14-16H,1-2,10H2,(H,17,18)/p-1/t3-,5+,6+,7+,8+/m0/s1 |
| InChIKey | BQINXKOTJQCISL-GRCPKETISA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neuraminate (CHEBI:25505) is a neuraminates (CHEBI:25506) |
| neuraminate (CHEBI:25505) is conjugate base of keto-neuraminic acid (CHEBI:27851) |
| Incoming Relation(s) |
| keto-neuraminic acid (CHEBI:27851) is conjugate acid of neuraminate (CHEBI:25505) |
| IUPAC Name |
|---|
| 5-amino-3,5-dideoxy-D-glycero-D-galacto-non-2-ulosonate |