EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O7P2 |
| Net Charge | 0 |
| Average Mass | 314.211 |
| Monoisotopic Mass | 314.06843 |
| SMILES | CC(C)=CCC/C(C)=C\COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C10H20O7P2/c1-9(2)5-4-6-10(3)7-8-16-19(14,15)17-18(11,12)13/h5,7H,4,6,8H2,1-3H3,(H,14,15)(H2,11,12,13)/b10-7- |
| InChIKey | GVVPGTZRZFNKDS-YFHOEESVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neryl diphosphate (CHEBI:16172) is a polyprenyl diphosphate (CHEBI:37531) |
| neryl diphosphate (CHEBI:16172) is conjugate acid of neryl diphosphate(3−) (CHEBI:57665) |
| Incoming Relation(s) |
| neryl diphosphate(3−) (CHEBI:57665) is conjugate base of neryl diphosphate (CHEBI:16172) |
| IUPAC Name |
|---|
| (2Z)-3,7-dimethylocta-2,6-dien-1-yl trihydrogen diphosphate |
| Synonyms | Source |
|---|---|
| Neryl diphosphate | KEGG COMPOUND |
| Neryl pyrophosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C02569 | KEGG COMPOUND |
| C02569 | KEGG COMPOUND |
| LMPR0102010002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:16751-02-3 | KEGG COMPOUND |