EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:25461 - myxothiazol
| Formula | C25H33N3O3S2 |
| Net Charge | 0 |
| Average Mass | 487.691 |
| Monoisotopic Mass | 487.19633 |
| SMILES | CO/C(=C/C(N)=O)[C@H](C)[C@H](/C=C/c1csc(-c2csc([C@@H](C)/C=C/C=C/C(C)C)n2)n1)OC |
| InChI | InChI=1S/C25H33N3O3S2/c1-16(2)9-7-8-10-17(3)24-28-20(15-33-24)25-27-19(14-32-25)11-12-21(30-5)18(4)22(31-6)13-23(26)29/h7-18,21H,1-6H3,(H2,26,29)/b9-7+,10-8+,12-11+,22-13+/t17-,18+,21-/m0/s1 |
| InChIKey | XKTFQMCPGMTBMD-FYHMSGCOSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myxococcus fulvus (ncbitaxon:33) | - | PubMed (7271921) | |
| Stigmatella aurantiaca DW4/3-1 (ncbitaxon:378806) | - | PubMed (11134965) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myxothiazol (CHEBI:25461) has role bacterial metabolite (CHEBI:76969) |
| myxothiazol (CHEBI:25461) has role geroprotector (CHEBI:176497) |
| myxothiazol (CHEBI:25461) has role mitochondrial respiratory-chain inhibitor (CHEBI:25355) |
| myxothiazol (CHEBI:25461) is a 1,3-thiazoles (CHEBI:38418) |
| myxothiazol (CHEBI:25461) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| (2E,4R,5S,6E)-3,5-dimethoxy-4-methyl-7-{2'-[(2S,3E,5E)-7-methylocta-3,5-dien-2-yl][2,4'-bi-1,3-thiazol]-4-yl}hepta-2,6-dienamide |
| Synonyms | Source |
|---|---|
| (+)-myxothiazol | ChEBI |
| Myxothiazol A | KEGG COMPOUND |
| (+)-myxothiazol A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:76706-55-3 | ChemIDplus |
| CAS:76706-55-3 | KEGG COMPOUND |
| Citations |
|---|