EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:254496 - 7,12-dimethyltetraphene
| Formula | C20H16 |
| Net Charge | 0 |
| Average Mass | 256.348 |
| Monoisotopic Mass | 256.12520 |
| SMILES | Cc1c2ccccc2c(C)c2c1ccc1ccccc12 |
| InChI | InChI=1S/C20H16/c1-13-16-8-5-6-9-17(16)14(2)20-18(13)12-11-15-7-3-4-10-19(15)20/h3-12H,1-2H3 |
| InChIKey | ARSRBNBHOADGJU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,12-dimethyltetraphene (CHEBI:254496) has role carcinogenic agent (CHEBI:50903) |
| 7,12-dimethyltetraphene (CHEBI:254496) is a ortho-fused polycyclic arene (CHEBI:35296) |
| 7,12-dimethyltetraphene (CHEBI:254496) is a tetraphenes (CHEBI:51067) |
| IUPAC Name |
|---|
| 7,12-dimethylbenzo[a]anthracene |
| Synonyms | Source |
|---|---|
| 1,4-Dimethyl-2,3-benzphenanthrene | NIST Chemistry WebBook |
| 6,7-Dimethyl-1,2-benzanthracene | ChemIDplus |
| 7,12-Dimethyl-1:2-benz(a)anthracene | ChemIDplus |
| 7,12-Dimethyl-1,2-benzanthracene | ChemIDplus |
| 7,12-Dimethylbenz(a)anthracene | ChemIDplus |
| 7,12-Dimethylbenzanthracene | ChemIDplus |
| Citations |
|---|