EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26O4 |
| Net Charge | 0 |
| Average Mass | 378.468 |
| Monoisotopic Mass | 378.18311 |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c(O)cc(O)cc1-c1cc2ccc(O)cc2o1 |
| InChI | InChI=1S/C24H26O4/c1-15(2)5-4-6-16(3)7-10-20-21(12-19(26)13-22(20)27)24-11-17-8-9-18(25)14-23(17)28-24/h5,7-9,11-14,25-27H,4,6,10H2,1-3H3/b16-7+ |
| InChIKey | KGOOVUKZICPAIZ-FRKPEAEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| albafuran A (CHEBI:2543) has role plant metabolite (CHEBI:76924) |
| albafuran A (CHEBI:2543) is a 1-benzofurans (CHEBI:38830) |
| albafuran A (CHEBI:2543) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 4-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-5-(6-hydroxy-1-benzofuran-2-yl)benzene-1,3-diol |
| Manual Xrefs | Databases |
|---|---|
| C08732 | KEGG COMPOUND |
| C00002391 | KNApSAcK |
| HMDB0030071 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5131474 | Reaxys |
| CAS:84323-14-8 | KEGG COMPOUND |
| CAS:84323-14-8 | ChemIDplus |
| Citations |
|---|