EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2542 - alatolide
| Formula | C19H26O6 |
| Net Charge | 0 |
| Average Mass | 350.411 |
| Monoisotopic Mass | 350.17294 |
| SMILES | [H][C@@]12/C=C(\CO)CC/C=C(\CO)C[C@H](OC(=O)C(C)C)[C@@]1([H])C(=C)C(=O)O2 |
| InChI | InChI=1S/C19H26O6/c1-11(2)18(22)24-15-7-13(9-20)5-4-6-14(10-21)8-16-17(15)12(3)19(23)25-16/h5,8,11,15-17,20-21H,3-4,6-7,9-10H2,1-2H3/b13-5-,14-8-/t15-,16+,17+/m0/s1 |
| InChIKey | IAKJNLGPQQXWAV-YINPGZOOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Jurinea alata (ncbitaxon:1628029) | - | Article (Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter51) | GRIN Nomen number: 20881 see:http://www.ars-grin.gov/cgi-bin/npgs/html/taxon.pl?20881#syn |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alatolide (CHEBI:2542) has role antineoplastic agent (CHEBI:35610) |
| alatolide (CHEBI:2542) has role plant metabolite (CHEBI:76924) |
| alatolide (CHEBI:2542) has role protein synthesis inhibitor (CHEBI:48001) |
| alatolide (CHEBI:2542) is a diol (CHEBI:23824) |
| alatolide (CHEBI:2542) is a germacrane sesquiterpenoid (CHEBI:68588) |
| alatolide (CHEBI:2542) is a olefinic compound (CHEBI:78840) |
| alatolide (CHEBI:2542) is a primary alcohol (CHEBI:15734) |
| alatolide (CHEBI:2542) is a sesquiterpene lactone (CHEBI:37667) |
| IUPAC Name |
|---|
| (1E,4Z)-14,15-dihydroxy-8α-(2-methylpropanoyloxy)germacra-1(10),4,11(13)-trieno-12,6α-lactone |
| Synonyms | Source |
|---|---|
| Alatolide | KEGG COMPOUND |
| Trihydroxygermaeranolide isobutyrate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C09290 | KEGG COMPOUND |
| C00003208 | KNApSAcK |
| LMPR0103090013 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4543272 | Reaxys |
| CAS:41929-10-6 | KEGG COMPOUND |
| CAS:41929-10-6 | ChemIDplus |
| Citations |
|---|