EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N2O4 |
| Net Charge | 0 |
| Average Mass | 382.460 |
| Monoisotopic Mass | 382.18926 |
| SMILES | [H][C@@]12C[C@@H]3/C(=C\C)CN1CC[C@@]14c5cc(O)ccc5N(C)[C@]12OCC34C(=O)OC |
| InChI | InChI=1S/C22H26N2O4/c1-4-13-11-24-8-7-21-16-9-14(25)5-6-17(16)23(2)22(21)18(24)10-15(13)20(21,12-28-22)19(26)27-3/h4-6,9,15,18,25H,7-8,10-12H2,1-3H3/b13-4-/t15-,18+,20?,21+,22-/m1/s1 |
| InChIKey | YILKZADAWNUTTB-HWIVZZNESA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Akuammine (CHEBI:2532) is a alkaloid (CHEBI:22315) |
| Akuammine (CHEBI:2532) is a methyl ester (CHEBI:25248) |
| Synonym | Source |
|---|---|
| Akuammine | KEGG COMPOUND |