EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17151 - xylitol
| Formula | C5H12O5 |
| Net Charge | 0 |
| Average Mass | 152.146 |
| Monoisotopic Mass | 152.06847 |
| SMILES | OC[C@@H](O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[h212h]/1/ |
| InChI | InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5+ |
| InChIKey | HEBKCHPVOIAQTA-SCDXWVJYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). sweetening agent Substance that sweeten food, beverages, medications, etc. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Application: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xylitol (CHEBI:17151) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| xylitol (CHEBI:17151) has role algal metabolite (CHEBI:84735) |
| xylitol (CHEBI:17151) has role allergen (CHEBI:50904) |
| xylitol (CHEBI:17151) has role hapten (CHEBI:59174) |
| xylitol (CHEBI:17151) has role human metabolite (CHEBI:77746) |
| xylitol (CHEBI:17151) has role mouse metabolite (CHEBI:75771) |
| xylitol (CHEBI:17151) has role sweetening agent (CHEBI:50505) |
| xylitol (CHEBI:17151) is a pentitol (CHEBI:25899) |
| Incoming Relation(s) |
| xylitol 5-phosphate (CHEBI:16772) has functional parent xylitol (CHEBI:17151) |
| xylitol 5-phosphate(2−) (CHEBI:370252) has functional parent xylitol (CHEBI:17151) |
| IUPAC Names |
|---|
| meso-xylitol |
| (2R,3r,4S)-pentane-1,2,3,4,5-pentol |
| Synonyms | Source |
|---|---|
| Xylitol | KEGG COMPOUND |
| xylite | NIST Chemistry WebBook |
| Xylit | ChEBI |
| D-XYLITOL | PDBeChem |
| (2R,3R,4S)-Pentane-1,2,3,4,5-pentaol | ChEMBL |
| L-xylitol | ChEBI |
| UniProt Name | Source |
|---|---|
| xylitol | UniProt |
| Citations |
|---|