EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N2O2 |
| Net Charge | 0 |
| Average Mass | 132.163 |
| Monoisotopic Mass | 132.08988 |
| SMILES | CCN(N=O)C(C)OC |
| InChI | InChI=1S/C5H12N2O2/c1-4-7(6-8)5(2)9-3/h5H,4H2,1-3H3 |
| InChIKey | DCUKVUVLSDGDEZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methoxy-N-nitrosodiethylamine (CHEBI:25234) has role mutagen (CHEBI:25435) |
| 1-methoxy-N-nitrosodiethylamine (CHEBI:25234) is a nitrosamine (CHEBI:35803) |
| IUPAC Name |
|---|
| N-ethyl-1-methoxy-N-nitrosoethanamine |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4368978 | Beilstein |
| CAS:61738-03-2 | ChemIDplus |