EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O4 |
| Net Charge | 0 |
| Average Mass | 282.295 |
| Monoisotopic Mass | 282.08921 |
| SMILES | COc1cc2c3c(ccc4cc(O)c(OC)c(c43)CO2)c1 |
| InChI | InChI=1S/C17H14O4/c1-19-11-5-9-3-4-10-6-13(18)17(20-2)12-8-21-14(7-11)16(9)15(10)12/h3-7,18H,8H2,1-2H3 |
| InChIKey | JUXGBQIIXCBKIW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Agrostophyllin (CHEBI:2520) is a phenanthrol (CHEBI:25962) |
| Synonym | Source |
|---|---|
| Agrostophyllin | KEGG COMPOUND |