EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N2 |
| Net Charge | 0 |
| Average Mass | 238.334 |
| Monoisotopic Mass | 238.14700 |
| SMILES | [H][C@@]12Cc3cnc4cccc(c34)[C@@]1([H])C=C(C)CN2C |
| InChI | InChI=1S/C16H18N2/c1-10-6-13-12-4-3-5-14-16(12)11(8-17-14)7-15(13)18(2)9-10/h3-6,8,13,15,17H,7,9H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | XJOOMMHNYOJWCZ-UKRRQHHQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| agroclavine (CHEBI:2519) is a ergot alkaloid (CHEBI:23943) |
| agroclavine (CHEBI:2519) is conjugate base of agroclavine(1+) (CHEBI:65042) |
| Incoming Relation(s) |
| agroclavine(1+) (CHEBI:65042) is conjugate acid of agroclavine (CHEBI:2519) |
| IUPAC Name |
|---|
| 6,8-dimethyl-8,9-didehydroergoline |
| Synonyms | Source |
|---|---|
| (5R,10R)-agroclavine | ChEBI |
| (6aR,10aR)-7,9-dimethyl-4,6,6a,7,8,10a-hexahydroindolo[4,3-fg]quinoline | IUPAC |
| 8,9-didehydro-6,8-dimethylergoline | ChemIDplus |
| (−)-agroclavine | ChEBI |
| Citations |
|---|