EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17NO6 |
| Net Charge | 0 |
| Average Mass | 295.291 |
| Monoisotopic Mass | 295.10559 |
| SMILES | N#CC(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C14H17NO6/c15-6-9(8-4-2-1-3-5-8)20-14-13(19)12(18)11(17)10(7-16)21-14/h1-5,9-14,16-19H,7H2/t9?,10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | ZKSZEJFBGODIJW-MXNNCRBYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prunasin (CHEBI:25150) has functional parent mandelonitrile (CHEBI:16910) |
| prunasin (CHEBI:25150) is a cyanogenic glycoside (CHEBI:23436) |
| prunasin (CHEBI:25150) is a monosaccharide derivative (CHEBI:63367) |
| prunasin (CHEBI:25150) is a nitrile (CHEBI:18379) |
| prunasin (CHEBI:25150) is a β-D-glucoside (CHEBI:22798) |
| Incoming Relation(s) |
| amygdalin (CHEBI:27613) has functional parent prunasin (CHEBI:25150) |
| (R)-prunasin (CHEBI:17396) is a prunasin (CHEBI:25150) |
| (S)-prunasin (CHEBI:27761) is a prunasin (CHEBI:25150) |
| IUPAC Name |
|---|
| (β-D-glucopyranosyloxy)(phenyl)acetonitrile |
| Synonyms | Source |
|---|---|
| mandelonitrile β-D-glucopyranoside | ChEBI |
| prunasin | ChemIDplus |
| mandelonitrile β-D-glucoside | ChEBI |
| α-(β-D-glucopyranosyloxy)benzeneacetonitrile | ChemIDplus |
| mandelonitrile glucoside | ChemIDplus |
| prulaurasin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9142960 | Beilstein |
| CAS:138-53-4 | ChemIDplus |
| Citations |
|---|