EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H52O9 |
| Net Charge | 0 |
| Average Mass | 592.770 |
| Monoisotopic Mass | 592.36113 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC(=O)[C@@]4(C)[C@@]3([H])C[C@]3([H])O[C@]5(CC[C@@H](C)CO5)[C@@H](C)[C@]43[H])[C@@]1(C)CC[C@H](O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)C2 |
| InChI | InChI=1S/C33H52O9/c1-16-7-10-33(39-15-16)17(2)26-23(42-33)12-22-20-6-5-18-11-19(40-30-29(38)28(37)27(36)24(14-34)41-30)8-9-31(18,3)21(20)13-25(35)32(22,26)4/h16-24,26-30,34,36-38H,5-15H2,1-4H3/t16-,17+,18+,19+,20-,21+,22+,23+,24-,26+,27+,28+,29-,30-,31+,32-,33-/m1/s1 |
| InChIKey | NVCUAFIUMZCPGV-RGIGLGGVSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| agavoside A (CHEBI:2513) has parent hydride (25R)-5α-spirostan (CHEBI:35539) |
| agavoside A (CHEBI:2513) is a monosaccharide derivative (CHEBI:63367) |
| agavoside A (CHEBI:2513) is a oxaspiro compound (CHEBI:37948) |
| agavoside A (CHEBI:2513) is a steroid saponin (CHEBI:61655) |
| IUPAC Name |
|---|
| (25R)-12-oxo-5α-spirostan-3β-yl β-D-galactopyranoside |
| Synonyms | Source |
|---|---|
| Agavoside A | KEGG COMPOUND |
| Agavosid A | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:56857-65-9 | KEGG COMPOUND |
| CAS:56857-65-9 | ChemIDplus |