EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H18O10 |
| Net Charge | 0 |
| Average Mass | 538.464 |
| Monoisotopic Mass | 538.09000 |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2cc(O)c(-c3c(O)cc(O)c4c(=O)cc(-c5ccc(O)cc5)oc34)c(O)c12 |
| InChI | InChI=1S/C30H18O10/c31-15-5-1-13(2-6-15)22-11-20(36)26-24(39-22)12-21(37)27(29(26)38)28-18(34)9-17(33)25-19(35)10-23(40-30(25)28)14-3-7-16(32)8-4-14/h1-12,31-34,37-38H |
| InChIKey | BACLASYRJRZXMY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| agathisflavone (CHEBI:2512) has role antineoplastic agent (CHEBI:35610) |
| agathisflavone (CHEBI:2512) has role antiviral agent (CHEBI:22587) |
| agathisflavone (CHEBI:2512) has role hepatoprotective agent (CHEBI:62868) |
| agathisflavone (CHEBI:2512) has role metabolite (CHEBI:25212) |
| agathisflavone (CHEBI:2512) is a biaryl (CHEBI:64459) |
| agathisflavone (CHEBI:2512) is a biflavonoid (CHEBI:50128) |
| agathisflavone (CHEBI:2512) is a hydroxyflavone (CHEBI:24698) |
| IUPAC Name |
|---|
| 5,5',7,7'-tetrahydroxy-2,2'-bis(4-hydroxyphenyl)-6,8'-bichromene-4,4'-dione |
| Synonyms | Source |
|---|---|
| 5,5',7,7'-tetrahydroxy-2,2'-bis(4-hydroxyphenyl)-(6,8'-bi-4H-1-benzopyran)-4,4'-dione | ChemIDplus |
| 6,8''-Biapigenin | KEGG COMPOUND |
| Agathisflavone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001014 | KNApSAcK |
| C10017 | KEGG COMPOUND |
| US2002068757 | Patent |
| WO9700679 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1415839 | Reaxys |
| CAS:28441-98-7 | KEGG COMPOUND |
| CAS:28441-98-7 | ChemIDplus |
| Citations |
|---|