EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26O10 |
| Net Charge | 0 |
| Average Mass | 546.528 |
| Monoisotopic Mass | 546.15260 |
| SMILES | Oc1ccc([C@H]2Oc3cc(O)cc(O)c3[C@@H](c3c(O)cc(O)c4c3O[C@H](c3ccc(O)cc3)[C@@H](O)C4)[C@@H]2O)cc1 |
| InChI | InChI=1S/C30H26O10/c31-15-5-1-13(2-6-15)28-22(37)11-18-19(34)12-21(36)25(30(18)40-28)26-24-20(35)9-17(33)10-23(24)39-29(27(26)38)14-3-7-16(32)8-4-14/h1-10,12,22,26-29,31-38H,11H2/t22-,26-,27-,28+,29+/m0/s1 |
| InChIKey | JESPWQGCCOLVKQ-AVFWISQGSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| afzelechin-(4α→8)-afzelechin (CHEBI:2508) has functional parent afzelechin (CHEBI:2507) |
| afzelechin-(4α→8)-afzelechin (CHEBI:2508) has role plant metabolite (CHEBI:76924) |
| afzelechin-(4α→8)-afzelechin (CHEBI:2508) is a biflavonoid (CHEBI:50128) |
| afzelechin-(4α→8)-afzelechin (CHEBI:2508) is a proanthocyanidin (CHEBI:26267) |
| IUPAC Name |
|---|
| (2R,2'R,3S,3'S,4S)-2,2'-bis(4-hydroxyphenyl)-3,3',4,4'-tetrahydro-2H,2'H-[4,8'-bi-1-benzopyran]-3,3',5,5',7,7'-hexol |