EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O5 |
| Net Charge | 0 |
| Average Mass | 298.294 |
| Monoisotopic Mass | 298.08412 |
| SMILES | COc1ccc(-c2coc3cc(O)c(OC)cc3c2=O)cc1 |
| InChI | InChI=1S/C17H14O5/c1-20-11-5-3-10(4-6-11)13-9-22-15-8-14(18)16(21-2)7-12(15)17(13)19/h3-9,18H,1-2H3 |
| InChIKey | KJGPBYUQZLUKLL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| afrormosin (CHEBI:2506) has functional parent isoflavone (CHEBI:18220) |
| afrormosin (CHEBI:2506) has role plant metabolite (CHEBI:76924) |
| afrormosin (CHEBI:2506) is a 4'-methoxyisoflavones (CHEBI:133959) |
| afrormosin (CHEBI:2506) is a 7-hydroxyisoflavones (CHEBI:55465) |
| IUPAC Name |
|---|
| 7-hydroxy-6-methoxy-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Manual Xrefs | Databases |
|---|---|
| C00002507 | KNApSAcK |
| C10199 | KEGG COMPOUND |
| LMPK12050100 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1293036 | Reaxys |
| CAS:550-79-8 | KEGG COMPOUND |
| CAS:550-79-8 | ChemIDplus |