EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O2 |
| Net Charge | 0 |
| Average Mass | 168.236 |
| Monoisotopic Mass | 168.11503 |
| SMILES | [H][C@@]1(C=O)[C@@H](C)CC[C@]1([H])[C@@H](C)C=O |
| InChI | InChI=1S/C10H16O2/c1-7-3-4-9(8(2)5-11)10(7)6-12/h5-10H,3-4H2,1-2H3/t7-,8-,9+,10+/m0/s1 |
| InChIKey | HMCYXRFNNOPPPR-AXTSPUMRSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-iridodial (CHEBI:25) has role plant metabolite (CHEBI:76924) |
| (+)-iridodial (CHEBI:25) is a iridodial (CHEBI:5964) |
| IUPAC Name |
|---|
| (1R,2S,5R)-2-methyl-5-[(1R)-1-methyl-2-oxoethyl]cyclopentanecarbaldehyde |
| Synonym | Source |
|---|---|
| (+)-Iridodial | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00003085 | KNApSAcK |
| C09785 | KEGG COMPOUND |
| LMPR0102070011 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4377783 | Reaxys |
| CAS:550-45-8 | KEGG COMPOUND |
| CAS:550-45-8 | ChemIDplus |