EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21NO3 |
| Net Charge | 0 |
| Average Mass | 347.414 |
| Monoisotopic Mass | 347.15214 |
| SMILES | COC(=O)c1c(C)nc(C)c1C(=O)c1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C22H21NO3/c1-14-19(20(15(2)23-14)22(25)26-3)21(24)18-12-8-7-11-17(18)13-16-9-5-4-6-10-16/h4-12,23H,13H2,1-3H3 |
| InChIKey | MDMWHKZANMNXTF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | calcium channel agonist Agents that increase calcium influx into calcium channels of excitable tissues. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FPL 64176 (CHEBI:249982) has role calcium channel agonist (CHEBI:38807) |
| FPL 64176 (CHEBI:249982) is a carboxylic ester (CHEBI:33308) |
| FPL 64176 (CHEBI:249982) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| methyl 4-(2-benzylbenzoyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate |
| Synonyms | Source |
|---|---|
| 4-(2-Benzyl-benzoyl)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid methyl ester | ChEMBL |
| Fpl 64176 | ChemIDplus |
| Fpl-64176 | ChemIDplus |
| FPL64176 | KEGG COMPOUND |
| Methyl-2,5-dimethyl-4-(2-(phenylmethyl)benzoyl)-1H-pyrrole-3-carboxylate | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5445217 | Reaxys |
| Beilstein:5445217 | Beilstein |
| CAS:120934-96-5 | KEGG COMPOUND |
| CAS:120934-96-5 | ChemIDplus |
| Citations |
|---|