EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2497 - Adynerin
| Formula | C30H44O7 |
| Net Charge | 0 |
| Average Mass | 516.675 |
| Monoisotopic Mass | 516.30870 |
| SMILES | [H][C@]12CC[C@@]34O[C@@]35CC[C@]([H])(C3=CC(=O)OC3)[C@@]5(C)CC[C@]4([H])[C@@]1(C)CC[C@H](O[C@H]1C[C@@H](OC)[C@@H](O)[C@@H](C)O1)C2 |
| InChI | InChI=1S/C30H44O7/c1-17-26(32)22(33-4)15-25(35-17)36-20-6-9-27(2)19(14-20)5-11-29-23(27)8-10-28(3)21(7-12-30(28,29)37-29)18-13-24(31)34-16-18/h13,17,19-23,25-26,32H,5-12,14-16H2,1-4H3/t17-,19-,20+,21-,22-,23-,25+,26+,27+,28-,29+,30-/m1/s1 |
| InChIKey | BYZQVAOKDQTHHP-QFUJVLJYSA-N |
| Roles Classification |
|---|
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Adynerin (CHEBI:2497) is a cardenolide glycoside (CHEBI:38092) |
| Synonyms | Source |
|---|---|
| Adynerigenin 3-O-beta-D-diginoside | KEGG COMPOUND |
| Adynerin | KEGG COMPOUND |