EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2495 - adrenosterone
| Formula | C19H24O3 |
| Net Charge | 0 |
| Average Mass | 300.398 |
| Monoisotopic Mass | 300.17254 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])C(=O)C[C@]1(C)C(=O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H24O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h9,13-14,17H,3-8,10H2,1-2H3/t13-,14-,17+,18-,19-/m0/s1 |
| InChIKey | RZRPTBIGEANTGU-IRIMSJTPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Abudefduf sexfasciatus (ncbitaxon:80948) | - | PubMed (25917864) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (14308712) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Sphyrna tiburo (ncbitaxon:7824) | - | PubMed (10469997) |
| Roles Classification |
|---|
| Biological Roles: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. EC 1.1.1.146 (11beta-hydroxysteroid dehydrogenase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of 11β-hydroxysteroid dehydrogenase (EC 1.1.1.146). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| adrenosterone (CHEBI:2495) has parent hydride androstane (CHEBI:35509) |
| adrenosterone (CHEBI:2495) has role androgen (CHEBI:50113) |
| adrenosterone (CHEBI:2495) has role EC 1.1.1.146 (11β-hydroxysteroid dehydrogenase) inhibitor (CHEBI:137626) |
| adrenosterone (CHEBI:2495) has role human urinary metabolite (CHEBI:84087) |
| adrenosterone (CHEBI:2495) has role marine metabolite (CHEBI:76507) |
| adrenosterone (CHEBI:2495) is a 11-oxo steroid (CHEBI:47787) |
| adrenosterone (CHEBI:2495) is a 17-oxo steroid (CHEBI:19168) |
| adrenosterone (CHEBI:2495) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| adrenosterone (CHEBI:2495) is a androstanoid (CHEBI:50402) |
| IUPAC Name |
|---|
| androst-4-ene-3,11,17-trione |
| Synonyms | Source |
|---|---|
| 11-ketoandrostenedione | ChEBI |
| 11-Keto-androstenedione | ChemIDplus |
| 11-OXO | ChemIDplus |
| 11-oxoandrost-4-ene-3,17-dione | MetaCyc |
| 11-oxoandrostenedione | ChEBI |
| 11-Oxy-4-androstenedione | ChemIDplus |
| UniProt Name | Source |
|---|---|
| androst-4-ene-3,11,17-trione | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C05285 | KEGG COMPOUND |
| CPD-18926 | MetaCyc |
| HMDB0006772 | HMDB |
| Citations |
|---|