EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O3 |
| Net Charge | 0 |
| Average Mass | 300.398 |
| Monoisotopic Mass | 300.17254 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])C(=O)C[C@]1(C)C(=O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H24O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h9,13-14,17H,3-8,10H2,1-2H3/t13-,14-,17+,18-,19-/m0/s1 |
| InChIKey | RZRPTBIGEANTGU-IRIMSJTPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Abudefduf sexfasciatus (ncbitaxon:80948) | - | PubMed (25917864) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (14308712) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Sphyrna tiburo (ncbitaxon:7824) | - | PubMed (10469997) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. EC 1.1.1.146 (11beta-hydroxysteroid dehydrogenase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of 11β-hydroxysteroid dehydrogenase (EC 1.1.1.146). human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| adrenosterone (CHEBI:2495) has parent hydride androstane (CHEBI:35509) |
| adrenosterone (CHEBI:2495) has role androgen (CHEBI:50113) |
| adrenosterone (CHEBI:2495) has role EC 1.1.1.146 (11β-hydroxysteroid dehydrogenase) inhibitor (CHEBI:137626) |
| adrenosterone (CHEBI:2495) has role human urinary metabolite (CHEBI:84087) |
| adrenosterone (CHEBI:2495) has role marine metabolite (CHEBI:76507) |
| adrenosterone (CHEBI:2495) is a 11-oxo steroid (CHEBI:47787) |
| adrenosterone (CHEBI:2495) is a 17-oxo steroid (CHEBI:19168) |
| adrenosterone (CHEBI:2495) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| adrenosterone (CHEBI:2495) is a androstanoid (CHEBI:50402) |
| IUPAC Name |
|---|
| androst-4-ene-3,11,17-trione |
| Synonyms | Source |
|---|---|
| 11-ketoandrostenedione | ChEBI |
| 11-Keto-androstenedione | ChemIDplus |
| 11-OXO | ChemIDplus |
| 11-oxoandrost-4-ene-3,17-dione | MetaCyc |
| 11-oxoandrostenedione | ChEBI |
| 11-Oxy-4-androstenedione | ChemIDplus |
| UniProt Name | Source |
|---|---|
| androst-4-ene-3,11,17-trione | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C05285 | KEGG COMPOUND |
| CPD-18926 | MetaCyc |
| HMDB0006772 | HMDB |
| Citations |
|---|