EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29N3O2 |
| Net Charge | 0 |
| Average Mass | 343.471 |
| Monoisotopic Mass | 343.22598 |
| SMILES | CCCCOc1cc(C(=O)NCCN(CC)CC)c2ccccc2n1 |
| InChI | InChI=1S/C20H29N3O2/c1-4-7-14-25-19-15-17(16-10-8-9-11-18(16)22-19)20(24)21-12-13-23(5-2)6-3/h8-11,15H,4-7,12-14H2,1-3H3,(H,21,24) |
| InChIKey | PUFQVTATUTYEAL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | topical anaesthetic A local anesthetic that is used to numb the surface of a body part. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cinchocaine (CHEBI:247956) has role topical anaesthetic (CHEBI:48425) |
| cinchocaine (CHEBI:247956) is a aromatic ether (CHEBI:35618) |
| cinchocaine (CHEBI:247956) is a monocarboxylic acid amide (CHEBI:29347) |
| cinchocaine (CHEBI:247956) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| cinchocaine hydrochloride (CHEBI:59735) has part cinchocaine (CHEBI:247956) |
| IUPAC Name |
|---|
| 2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide |
| INNs | Source |
|---|---|
| cinchocaine | ChEBI |
| cinchocainum | ChemIDplus |
| cincocainio | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-butoxy-N-[2-(diethylamino)ethyl]-4-quinolinecarboxamide | NIST Chemistry WebBook |
| 2-butoxy-N-(2-(diethylamino)ethyl)cinchoninamide | ChemIDplus |
| 2-butoxy-N-(α-diethylaminoethyl)cinchoninamide | ChemIDplus |
| 2-butoxy-N-(β-diethylaminoethyl)cinchoninamide | NIST Chemistry WebBook |
| 2-Butoxy-quinoline-4-carboxylic acid (2-diethylamino-ethyl)-amide | ChEMBL |
| 2-butoxyquinoline-4-carboxylic acid diethylaminoethylamide | ChemIDplus |
| Citations |
|---|