EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H7NO2S |
| Net Charge | 0 |
| Average Mass | 109.150 |
| Monoisotopic Mass | 109.01975 |
| SMILES | NCCS(=O)O |
| InChI | InChI=1S/C2H7NO2S/c3-1-2-6(4)5/h1-3H2,(H,4,5) |
| InChIKey | VVIUBCNYACGLLV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hypotaurine (CHEBI:16668) has role human metabolite (CHEBI:77746) |
| hypotaurine (CHEBI:16668) has role metabolite (CHEBI:25212) |
| hypotaurine (CHEBI:16668) has role mouse metabolite (CHEBI:75771) |
| hypotaurine (CHEBI:16668) is a aminosulfinic acid (CHEBI:37794) |
| hypotaurine (CHEBI:16668) is conjugate acid of hypotaurine(1−) (CHEBI:140741) |
| hypotaurine (CHEBI:16668) is tautomer of hypotaurine zwitterion (CHEBI:57853) |
| Incoming Relation(s) |
| hypotaurocyamine (CHEBI:16209) has functional parent hypotaurine (CHEBI:16668) |
| hypotaurine(1−) (CHEBI:140741) is conjugate base of hypotaurine (CHEBI:16668) |
| hypotaurine zwitterion (CHEBI:57853) is tautomer of hypotaurine (CHEBI:16668) |
| IUPAC Name |
|---|
| 2-aminoethanesulfinic acid |
| Synonyms | Source |
|---|---|
| 2-Aminoethanesulfinic acid | KEGG COMPOUND |
| Hypotaurine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00519 | KEGG COMPOUND |
| HMDB0000965 | HMDB |
| Hypotaurine | Wikipedia |
| HYPOTAURINE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1743127 | Reaxys |
| CAS:300-84-5 | KEGG COMPOUND |
| CAS:300-84-5 | ChemIDplus |
| Citations |
|---|