EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18N6 |
| Net Charge | 0 |
| Average Mass | 210.285 |
| Monoisotopic Mass | 210.15929 |
| SMILES | CN(C)c1nc(N(C)C)nc(N(C)C)n1 |
| InChI | InChI=1S/C9H18N6/c1-13(2)7-10-8(14(3)4)12-9(11-7)15(5)6/h1-6H3 |
| InChIKey | UUVWYPNAQBNQJQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexamethylmelamine (CHEBI:24564) has role antineoplastic agent (CHEBI:35610) |
| hexamethylmelamine (CHEBI:24564) is a triamino-1,3,5-triazine (CHEBI:38175) |
| IUPAC Name |
|---|
| N,N,N',N',N'',N''-hexamethyl-1,3,5-triazine-2,4,6-triamine |
| INNs | Source |
|---|---|
| altretamina | ChemIDplus |
| altretamine | ChemIDplus |
| altretaminum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2,4,6-tris(dimethylamino)-1,3,5-triazine | ChemIDplus |
| 2,4,6-tris(dimethylamino)-s-triazine | NIST Chemistry WebBook |
| altretamine | ChEMBL |
| HMM | ChemIDplus |
| NSC-13875 | ChEMBL |
| Brand Names | Source |
|---|---|
| Hexalen | ChemIDplus |
| Hexastat | ChemIDplus |
| Citations |
|---|