EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6N6O6 |
| Net Charge | 0 |
| Average Mass | 222.117 |
| Monoisotopic Mass | 222.03488 |
| SMILES | O=[N+]([O-])N1CN([N+](=O)[O-])CN([N+](=O)[O-])C1 |
| InChI | InChI=1S/C3H6N6O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H2 |
| InChIKey | XTFIVUDBNACUBN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | explosive A substance capable of undergoing rapid and highly exothermic decomposition. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,5-trinitro-1,3,5-triazinane (CHEBI:24556) has role explosive (CHEBI:63490) |
| 1,3,5-trinitro-1,3,5-triazinane (CHEBI:24556) is a N-nitro compound (CHEBI:38780) |
| 1,3,5-trinitro-1,3,5-triazinane (CHEBI:24556) is a 1,3,5-triazinanes (CHEBI:38779) |
| IUPAC Name |
|---|
| 1,3,5-trinitro-1,3,5-triazinane |
| Synonyms | Source |
|---|---|
| 1,3,5-trinitro-1,3,5-triazacyclohexane | ChemIDplus |
| 1,3,5-trinitrohexahydro-1,3,5-triazine | ChemIDplus |
| 1,3,5-trinitrohexahydro-s-triazine | ChemIDplus |
| Cyclonite | ChemIDplus |
| cyclotrimethylenetrinitramine | ChemIDplus |
| sym-trimethylene trinitramine | ChemIDplus |
| Citations |
|---|