EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2453 - acyclovir
| Formula | C8H11N5O3 |
| Net Charge | 0 |
| Average Mass | 225.208 |
| Monoisotopic Mass | 225.08619 |
| SMILES | Nc1nc(=O)c2ncn(COCCO)c2n1 |
| InChI | InChI=1S/C8H11N5O3/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14/h3,14H,1-2,4H2,(H3,9,11,12,15) |
| InChIKey | MKUXAQIIEYXACX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acyclovir (CHEBI:2453) has functional parent guanine (CHEBI:16235) |
| acyclovir (CHEBI:2453) has role antimetabolite (CHEBI:35221) |
| acyclovir (CHEBI:2453) has role antiviral drug (CHEBI:36044) |
| acyclovir (CHEBI:2453) is a 2-aminopurines (CHEBI:20702) |
| acyclovir (CHEBI:2453) is a oxopurine (CHEBI:25810) |
| IUPAC Name |
|---|
| 2-amino-9-[(2-hydroxyethoxy)methyl]-1,9-dihydro-6H-purin-6-one |
| INNs | Source |
|---|---|
| aciclovirum | ChemIDplus |
| aciclovir | ChEBI |
| Synonym | Source |
|---|---|
| acycloguanosine | ChEBI |
| Brand Name | Source |
|---|---|
| Zovir | DrugBank |
| UniProt Name | Source |
|---|---|
| acyclovir | UniProt |
| Citations |
|---|