EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22ClNO6 |
| Net Charge | 0 |
| Average Mass | 383.828 |
| Monoisotopic Mass | 383.11357 |
| SMILES | COC1=CC(=O)[C@@]2([C@@H]1O)[C@@H](Cl)C[C@]13NCC[C@]21CC(=O)C(OC)=C3OC |
| InChI | InChI=1S/C18H22ClNO6/c1-24-10-6-12(22)18(14(10)23)11(19)8-17-15(26-3)13(25-2)9(21)7-16(17,18)4-5-20-17/h6,11,14,20,23H,4-5,7-8H2,1-3H3/t11-,14+,16+,17+,18+/m0/s1 |
| InChIKey | SBALNGLYQFMKPR-NQTWQHAWSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Acutumidine (CHEBI:2452) is a alkaloid (CHEBI:22315) |
| Synonym | Source |
|---|---|
| Acutumidine | KEGG COMPOUND |