EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C51H82N8O17 |
| Net Charge | 0 |
| Average Mass | 1079.256 |
| Monoisotopic Mass | 1078.57979 |
| SMILES | CCCCCCCCCCCCCCCC(=O)N[C@H]1C[C@@H](O)[C@@H](O)NC(=O)[C@@H]2[C@@H](O)[C@@H](C)CN2C(=O)[C@H]([C@H](O)CC(N)=O)NC(=O)[C@H]([C@H](O)[C@@H](O)c2ccc(O)cc2)NC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@H]([C@@H](C)O)NC1=O |
| InChI | InChI=1S/C51H82N8O17/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-37(66)53-32-23-35(64)47(72)57-49(74)41-42(67)27(2)25-59(41)51(76)39(34(63)24-36(52)65)55-48(73)40(44(69)43(68)29-18-20-30(61)21-19-29)56-46(71)33-22-31(62)26-58(33)50(75)38(28(3)60)54-45(32)70/h18-21,27-28,31-35,38-44,47,60-64,67-69,72H,4-17,22-26H2,1-3H3,(H2,52,65)(H,53,66)(H,54,70)(H,55,73)(H,56,71)(H,57,74)/t27-,28+,31+,32-,33-,34+,35+,38-,39-,40-,41-,42-,43-,44-,47+/m0/s1 |
| InChIKey | FBCLKBXYZRAXNA-PDIPHZEPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus aculeatus (ncbitaxon:5053) | - | PubMed (324959) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aculeacin A (CHEBI:2450) has role Aspergillus metabolite (CHEBI:76956) |
| aculeacin A (CHEBI:2450) has role antifungal agent (CHEBI:35718) |
| aculeacin A (CHEBI:2450) has role antimicrobial agent (CHEBI:33281) |
| aculeacin A (CHEBI:2450) is a heterodetic cyclic peptide (CHEBI:24533) |
| aculeacin A (CHEBI:2450) is a lipopeptide (CHEBI:46895) |
| Synonyms | Source |
|---|---|
| Aculeacin A | KEGG COMPOUND |
| aculeacin A | IUBMB |
| Aculeacins | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:26317172 | Reaxys |
| CAS:58814-86-1 | KEGG COMPOUND |
| CAS:58814-86-1 | ChemIDplus |
| Citations |
|---|