EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C51H82N8O17 |
| Net Charge | 0 |
| Average Mass | 1079.256 |
| Monoisotopic Mass | 1078.57979 |
| SMILES | CCCCCCCCCCCCCCCC(=O)N[C@H]1C[C@@H](O)[C@@H](O)NC(=O)[C@@H]2[C@@H](O)[C@@H](C)CN2C(=O)[C@H]([C@H](O)CC(N)=O)NC(=O)[C@H]([C@H](O)[C@@H](O)c2ccc(O)cc2)NC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@H]([C@@H](C)O)NC1=O |
| InChI | InChI=1S/C51H82N8O17/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-37(66)53-32-23-35(64)47(72)57-49(74)41-42(67)27(2)25-59(41)51(76)39(34(63)24-36(52)65)55-48(73)40(44(69)43(68)29-18-20-30(61)21-19-29)56-46(71)33-22-31(62)26-58(33)50(75)38(28(3)60)54-45(32)70/h18-21,27-28,31-35,38-44,47,60-64,67-69,72H,4-17,22-26H2,1-3H3,(H2,52,65)(H,53,66)(H,54,70)(H,55,73)(H,56,71)(H,57,74)/t27-,28+,31+,32-,33-,34+,35+,38-,39-,40-,41-,42-,43-,44-,47+/m0/s1 |
| InChIKey | FBCLKBXYZRAXNA-PDIPHZEPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus aculeatus (ncbitaxon:5053) | - | PubMed (324959) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aculeacin A (CHEBI:2450) has role Aspergillus metabolite (CHEBI:76956) |
| aculeacin A (CHEBI:2450) has role antifungal agent (CHEBI:35718) |
| aculeacin A (CHEBI:2450) has role antimicrobial agent (CHEBI:33281) |
| aculeacin A (CHEBI:2450) is a heterodetic cyclic peptide (CHEBI:24533) |
| aculeacin A (CHEBI:2450) is a lipopeptide (CHEBI:46895) |
| Synonyms | Source |
|---|---|
| aculeacin A | IUBMB |
| Aculeacin A | KEGG COMPOUND |
| Aculeacins | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:26317172 | Reaxys |
| CAS:58814-86-1 | ChemIDplus |
| CAS:58814-86-1 | KEGG COMPOUND |
| Citations |
|---|