EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H26O14 |
| Net Charge | 0 |
| Average Mass | 634.546 |
| Monoisotopic Mass | 634.13226 |
| SMILES | C[C@H]1O[C@H](CC(=O)O)CC2=C1C(=O)c1c(O)c(-c3cc(O)c4c(c3O)C(=O)C3=C(C[C@@H](CC(=O)O)O[C@@H]3C)C4=O)cc(O)c1C2=O |
| InChI | InChI=1S/C32H26O14/c1-9-21-15(3-11(45-9)5-19(35)36)29(41)23-17(33)7-13(27(39)25(23)31(21)43)14-8-18(34)24-26(28(14)40)32(44)22-10(2)46-12(6-20(37)38)4-16(22)30(24)42/h7-12,33-34,39-40H,3-6H2,1-2H3,(H,35,36)(H,37,38)/t9-,10-,11+,12+/m1/s1 |
| InChIKey | VTIKDEXOEJDMJP-WYUUTHIRSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces coelicolor A3(2) (ncbitaxon:100226) | - | PubMed (17579485) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| actinorhodin (CHEBI:2448) has role antimicrobial agent (CHEBI:33281) |
| actinorhodin (CHEBI:2448) has role bacterial metabolite (CHEBI:76969) |
| actinorhodin (CHEBI:2448) is a p-quinones (CHEBI:25830) |
| actinorhodin (CHEBI:2448) is a benzoisochromanequinone (CHEBI:48129) |
| actinorhodin (CHEBI:2448) is a dicarboxylic acid (CHEBI:35692) |
| actinorhodin (CHEBI:2448) is a polyketide (CHEBI:26188) |
| actinorhodin (CHEBI:2448) is a polyphenol (CHEBI:26195) |
| actinorhodin (CHEBI:2448) is a ring assembly (CHEBI:36820) |
| actinorhodin (CHEBI:2448) is conjugate acid of actinorhodin(3−) (CHEBI:91020) |
| Incoming Relation(s) |
| actinorhodin(3−) (CHEBI:91020) is conjugate base of actinorhodin (CHEBI:2448) |
| IUPAC Name |
|---|
| 2,2'-[(1R,1'R,3S,3'S)-6,6',9,9'-tetrahydroxy-1,1'-dimethyl-5,5',10,10'-tetraoxo-3,3',4,4',5,5',10,10'-octahydro-1H,1'H-[8,8'-bibenzo[g]isochromene]-3,3'-diyl]diacetic acid |
| Synonyms | Source |
|---|---|
| Actinorhodine | KEGG COMPOUND |
| Actinorhodin | ChemIDplus |
| 2,2'-[(1R,1'R,3S,3'S)-6,6',9,9'-tetrahydroxy-1,1'-dimethyl-5,5',10,10'-tetraoxo-3,3',4,4',5,5',10,10'-octahydro-1H,1'H-[8,8'-binaphtho[2,3-c]pyran]-3,3'-diyl]diacetic acid | IUPAC |
| Actinorhodin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C06691 | KEGG COMPOUND |
| ZCT | PDBeChem |
| CPD1A0-6123 | MetaCyc |
| Actinorhodin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:76401 | Beilstein |
| Reaxys:22788170 | Reaxys |
| CAS:1397-77-9 | KEGG COMPOUND |
| CAS:1397-77-9 | ChemIDplus |
| Citations |
|---|