EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N |
| Net Charge | 0 |
| Average Mass | 147.221 |
| Monoisotopic Mass | 147.10480 |
| SMILES | Cc1cncc2c1CC[C@@H]2C |
| InChI | InChI=1S/C10H13N/c1-7-3-4-9-8(2)5-11-6-10(7)9/h5-7H,3-4H2,1-2H3/t7-/m0/s1 |
| InChIKey | ZHQQRIUYLMXDPP-ZETCQYMHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinidia polygama (ncbitaxon:64480) | - | PubMed (6061704) | |
| Valeriana officinalis (ncbitaxon:19953) | root (BTO:0001188) | PubMed (547813) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| actinidine (CHEBI:2443) has role pheromone (CHEBI:26013) |
| actinidine (CHEBI:2443) has role plant metabolite (CHEBI:76924) |
| actinidine (CHEBI:2443) is a cyclopentapyridine (CHEBI:37940) |
| actinidine (CHEBI:2443) is a pyridine alkaloid (CHEBI:26416) |
| IUPAC Name |
|---|
| (7S)-4,7-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine |
| Synonyms | Source |
|---|---|
| Actinidine | KEGG COMPOUND |
| (S)-(−)-actidine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Actinidine | Wikipedia |
| C00001961 | KNApSAcK |
| C09910 | KEGG COMPOUND |
| HMDB0030346 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:81308 | Reaxys |
| CAS:524-03-8 | ChemIDplus |
| CAS:524-03-8 | KEGG COMPOUND |
| Citations |
|---|