EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N |
| Net Charge | 0 |
| Average Mass | 147.221 |
| Monoisotopic Mass | 147.10480 |
| SMILES | Cc1cncc2c1CC[C@@H]2C |
| InChI | InChI=1S/C10H13N/c1-7-3-4-9-8(2)5-11-6-10(7)9/h5-7H,3-4H2,1-2H3/t7-/m0/s1 |
| InChIKey | ZHQQRIUYLMXDPP-ZETCQYMHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinidia polygama (ncbitaxon:64480) | - | PubMed (6061704) | |
| Valeriana officinalis (ncbitaxon:19953) | root (BTO:0001188) | PubMed (547813) |
| Roles Classification |
|---|
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| actinidine (CHEBI:2443) has role pheromone (CHEBI:26013) |
| actinidine (CHEBI:2443) has role plant metabolite (CHEBI:76924) |
| actinidine (CHEBI:2443) is a cyclopentapyridine (CHEBI:37940) |
| actinidine (CHEBI:2443) is a pyridine alkaloid (CHEBI:26416) |
| IUPAC Name |
|---|
| (7S)-4,7-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine |
| Synonyms | Source |
|---|---|
| Actinidine | KEGG COMPOUND |
| (S)-(−)-actidine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Actinidine | Wikipedia |
| C00001961 | KNApSAcK |
| C09910 | KEGG COMPOUND |
| HMDB0030346 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:81308 | Reaxys |
| CAS:524-03-8 | ChemIDplus |
| CAS:524-03-8 | KEGG COMPOUND |
| Citations |
|---|