EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17ClO6 |
| Net Charge | 0 |
| Average Mass | 352.770 |
| Monoisotopic Mass | 352.07137 |
| SMILES | COC1=CC(=O)C[C@@H](C)[C@]12Oc1c(Cl)c(OC)cc(OC)c1C2=O |
| InChI | InChI=1S/C17H17ClO6/c1-8-5-9(19)6-12(23-4)17(8)16(20)13-10(21-2)7-11(22-3)14(18)15(13)24-17/h6-8H,5H2,1-4H3/t8-,17+/m1/s1 |
| InChIKey | DDUHZTYCFQRHIY-RBHXEPJQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| griseofulvin (CHEBI:27779) has role Penicillium metabolite (CHEBI:76964) |
| griseofulvin (CHEBI:27779) has role antibacterial agent (CHEBI:33282) |
| griseofulvin (CHEBI:27779) has role antiinfective agent (CHEBI:35441) |
| griseofulvin (CHEBI:27779) is a 1-benzofurans (CHEBI:38830) |
| griseofulvin (CHEBI:27779) is a antibiotic antifungal drug (CHEBI:87113) |
| griseofulvin (CHEBI:27779) is a benzofuran antifungal drug (CHEBI:87128) |
| griseofulvin (CHEBI:27779) is a organochlorine compound (CHEBI:36683) |
| griseofulvin (CHEBI:27779) is a oxaspiro compound (CHEBI:37948) |
| IUPAC Name |
|---|
| (2S,6'R)-7-chloro-2',4,6-trimethoxy-6'-methyl-3H,4'H-spiro[1-benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione |
| INNs | Source |
|---|---|
| griseofulvin | KEGG DRUG |
| griseofulvina | ChemIDplus |
| griséofulvine | ChemIDplus |
| griseofulvinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| amudane | NIST Chemistry WebBook |
| Grisactin v | ChEMBL |
| (+)-griseofulvin | NIST Chemistry WebBook |
| Griseofulvin | KEGG COMPOUND |
| Griseofulvin microsize | ChEMBL |
| Griseofulvin,microsize | ChEMBL |
| Brand Names | Source |
|---|---|
| Curling factor | DrugBank |
| Fulcin | DrugBank |
| Fulcin 125 | ChEMBL |
| Fulcin 500 | ChEMBL |
| Fulsovin | ChEMBL |
| Fulvicin | DrugBank |
| UniProt Name | Source |
|---|---|
| griseofulvin | UniProt |
| Citations |
|---|