EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H4O3 |
| Net Charge | 0 |
| Average Mass | 76.051 |
| Monoisotopic Mass | 76.01604 |
| SMILES | O=C(O)CO |
| InChI | InChI=1S/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5) |
| InChIKey | AEMRFAOFKBGASW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | keratolytic drug A drug that softens, separates, and causes desquamation of the cornified epithelium or horny layer of skin. Keratolytic drugs are used to expose mycelia of infecting fungi or to treat corns, warts, and certain other skin diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycolic acid (CHEBI:17497) has functional parent acetic acid (CHEBI:15366) |
| glycolic acid (CHEBI:17497) has role keratolytic drug (CHEBI:50176) |
| glycolic acid (CHEBI:17497) has role metabolite (CHEBI:25212) |
| glycolic acid (CHEBI:17497) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| glycolic acid (CHEBI:17497) is a primary alcohol (CHEBI:15734) |
| glycolic acid (CHEBI:17497) is conjugate acid of glycolate (CHEBI:29805) |
| Incoming Relation(s) |
| (benzyloxy)acetic acid (CHEBI:180539) has functional parent glycolic acid (CHEBI:17497) |
| 2-phosphoglycolic acid (CHEBI:17150) has functional parent glycolic acid (CHEBI:17497) |
| caffeoylglycolic acid methyl ester (CHEBI:65548) has functional parent glycolic acid (CHEBI:17497) |
| glycolate ester (CHEBI:37938) has functional parent glycolic acid (CHEBI:17497) |
| phenoxyacetic acid (CHEBI:8075) has functional parent glycolic acid (CHEBI:17497) |
| phosphoglycolohydroxamic acid (CHEBI:28475) has functional parent glycolic acid (CHEBI:17497) |
| ureidoglycolic acid (CHEBI:49050) has functional parent glycolic acid (CHEBI:17497) |
| glycolate (CHEBI:29805) is conjugate base of glycolic acid (CHEBI:17497) |
| IUPAC Name |
|---|
| hydroxyacetic acid |
| Synonyms | Source |
|---|---|
| 2-Hydroxyacetic acid | ChemIDplus |
| 2-Hydroxyethanoic acid | NIST Chemistry WebBook |
| alpha-Hydroxyacetic acid | HMDB |
| Glycolic acid | KEGG COMPOUND |
| GLYCOLIC ACID | PDBeChem |
| Glycollic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4645 | DrugCentral |
| C00007461 | KNApSAcK |
| C00160 | KEGG COMPOUND |
| Glycolic_acid | Wikipedia |
| GLYCOLLATE | MetaCyc |
| GOA | PDBeChem |
| HMDB0000115 | HMDB |
| LMFA01050148 | LIPID MAPS |
| Citations |
|---|