EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23ClO7 |
| Net Charge | 0 |
| Average Mass | 398.839 |
| Monoisotopic Mass | 398.11323 |
| SMILES | [H][C@]12OC(=O)C(=C)[C@]1([H])[C@@H](OC(=O)[C@](C)(O)CCl)CC(=C)[C@]1([H])C[C@H](O)[C@@]3(CO3)[C@]21[H] |
| InChI | InChI=1S/C19H23ClO7/c1-8-4-11(26-17(23)18(3,24)6-20)13-9(2)16(22)27-15(13)14-10(8)5-12(21)19(14)7-25-19/h10-15,21,24H,1-2,4-7H2,3H3/t10-,11-,12-,13+,14-,15-,18+,19-/m0/s1 |
| InChIKey | RFRUYYQMUJRBAN-LKUPFZQBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acroptilon (ncbitaxon:41465) | leaf (BTO:0000713) | Article (Chemistry of Natural Compounds, 1973, Volume 9, pp 156-161) | |
| Centaurea (ncbitaxon:41503) | - | Article (Chemistry of Natural Compounds, 1973, Volume 9, pp 156-161) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acroptilin (CHEBI:2439) has role anti-allergic agent (CHEBI:50857) |
| acroptilin (CHEBI:2439) has role plant metabolite (CHEBI:76924) |
| acroptilin (CHEBI:2439) is a azulenofuran (CHEBI:39433) |
| acroptilin (CHEBI:2439) is a epoxide (CHEBI:32955) |
| acroptilin (CHEBI:2439) is a olefinic compound (CHEBI:78840) |
| acroptilin (CHEBI:2439) is a organic heterotetracyclic compound (CHEBI:38163) |
| acroptilin (CHEBI:2439) is a organochlorine compound (CHEBI:36683) |
| acroptilin (CHEBI:2439) is a secondary alcohol (CHEBI:35681) |
| acroptilin (CHEBI:2439) is a sesquiterpene lactone (CHEBI:37667) |
| acroptilin (CHEBI:2439) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (3aR,4S,6aR,8S,9S,9aS,9bS)-8-hydroxy-3,6-bis(methylidene)-2-oxodecahydro-2H-spiro[azuleno[4,5-b]furan-9,2'-oxiran]-4-yl (2S)-3-chloro-2-hydroxy-2-methylpropanoate |
| Synonyms | Source |
|---|---|
| Acroptilin | KEGG COMPOUND |
| Chlorohyssopifolin C | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:41787-75-1 | KEGG COMPOUND |
| CAS:41787-75-1 | ChemIDplus |