EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17NO4 |
| Net Charge | 0 |
| Average Mass | 311.337 |
| Monoisotopic Mass | 311.11576 |
| SMILES | COc1cc2nc3occc3c(OC)c2c2c1OC(C)(C)C=C2 |
| InChI | InChI=1S/C18H17NO4/c1-18(2)7-5-10-14-12(9-13(20-3)15(10)23-18)19-17-11(6-8-22-17)16(14)21-4/h5-9H,1-4H3 |
| InChIKey | MUJFBNIGLPDCAE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acronychia (ncbitaxon:43714) | - | Article (Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter27) | |
| Melicope (ncbitaxon:77014) | - | Article (Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter27) | |
| Sarcomelicope (ncbitaxon:76971) | - | Article (Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter27) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acronidine (CHEBI:2435) has role plant metabolite (CHEBI:76924) |
| acronidine (CHEBI:2435) is a aromatic ether (CHEBI:35618) |
| acronidine (CHEBI:2435) is a organic heterotetracyclic compound (CHEBI:38163) |
| acronidine (CHEBI:2435) is a quinoline alkaloid (CHEBI:26509) |
| IUPAC Name |
|---|
| 5,11-dimethoxy-3,3-dimethyl-3H-furo[2,3-b]pyrano[3,2-f]quinoline |
| Synonym | Source |
|---|---|
| Acronidine | KEGG COMPOUND |