EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23NO2 |
| Net Charge | 0 |
| Average Mass | 261.365 |
| Monoisotopic Mass | 261.17288 |
| SMILES | [H][C@@]12CCCN3CCC=C4[C@H](C[C@H]1O)C(=O)[C@H](C)C[C@]432 |
| InChI | InChI=1S/C16H23NO2/c1-10-9-16-12-4-2-6-17(16)7-3-5-13(16)14(18)8-11(12)15(10)19/h4,10-11,13-14,18H,2-3,5-9H2,1H3/t10-,11+,13-,14-,16-/m1/s1 |
| InChIKey | NKDOONPOQHRNLY-DVAKLYJDSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acrifoline (CHEBI:2433) has functional parent lycopodine (CHEBI:6597) |
| acrifoline (CHEBI:2433) is a quinolizidine alkaloid (CHEBI:26515) |
| IUPAC Name |
|---|
| (15R)-5β-hydroxy-15-methyllycopod-11-en-8-one |
| Synonym | Source |
|---|---|
| Acrifoline | KEGG COMPOUND |
| Citations |
|---|