EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2431 - acremoauxin A
| Formula | C16H21NO6 |
| Net Charge | 0 |
| Average Mass | 323.345 |
| Monoisotopic Mass | 323.13689 |
| SMILES | C[C@@H](C(=O)OC[C@@H](O)[C@H](O)[C@H](O)CO)c1cnc2ccccc12 |
| InChI | InChI=1S/C16H21NO6/c1-9(11-6-17-12-5-3-2-4-10(11)12)16(22)23-8-14(20)15(21)13(19)7-18/h2-6,9,13-15,17-21H,7-8H2,1H3/t9-,13-,14-,15-/m1/s1 |
| InChIKey | YBXVDDODTFXOHM-SEWBAHNZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paecilomyces sp. (ncbitaxon:40383) | - | PubMed (22692953) | Isolated from cultures Strain: CAFT156 |
| Roles Classification |
|---|
| Biological Roles: | plant growth regulator A chemical, natural or artificial, that can affect the rate of growth of a plant. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acremoauxin A (CHEBI:2431) has functional parent D-arabinitol (CHEBI:18333) |
| acremoauxin A (CHEBI:2431) has role fungal metabolite (CHEBI:76946) |
| acremoauxin A (CHEBI:2431) has role plant growth regulator (CHEBI:26155) |
| acremoauxin A (CHEBI:2431) has role plant metabolite (CHEBI:76924) |
| acremoauxin A (CHEBI:2431) is a indolyl carboxylate ester (CHEBI:46939) |
| acremoauxin A (CHEBI:2431) is a pentitol derivative (CHEBI:63434) |
| IUPAC Name |
|---|
| (2R,3R,4R)-2,3,4,5-tetrahydroxypentyl (2R)-2-(1H-indol-3-yl)propanoate |
| Synonyms | Source |
|---|---|
| Acremoauxin A | KEGG COMPOUND |
| 2-(3-Indolyl)propanoylmannitol | KEGG COMPOUND |
| Citations |
|---|