EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O3 |
| Net Charge | 0 |
| Average Mass | 246.306 |
| Monoisotopic Mass | 246.12559 |
| SMILES | [H][C@]12C(C)=CC(=O)C1=C(C)CC[C@@]1([H])[C@@H](C)C(=O)O[C@]21[H] |
| InChI | InChI=1S/C15H18O3/c1-7-4-5-10-9(3)15(17)18-14(10)13-8(2)6-11(16)12(7)13/h6,9-10,13-14H,4-5H2,1-3H3/t9-,10+,13+,14+/m1/s1 |
| InChIKey | BJPSSVHNEGMBDQ-OAACRXHESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anthemis scrobicularis (ncbitaxon:589792) | aerial part (BTO:0001658) | PubMed (25227949) | |
| Artemisia feddei (ncbitaxon:637478) | - | PubMed (25227949) |
| Roles Classification |
|---|
| Biological Roles: | nitric oxide synthase activator Any compound that binds to and activates the enzyme nitric oxide synthase (EC 1.14.13.39). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| achillin (CHEBI:2425) has role nitric oxide synthase activator (CHEBI:73966) |
| achillin (CHEBI:2425) has role plant metabolite (CHEBI:76924) |
| achillin (CHEBI:2425) is a azulenofuran (CHEBI:39433) |
| achillin (CHEBI:2425) is a sesquiterpene lactone (CHEBI:37667) |
| IUPAC Name |
|---|
| (3R,3aS,9aS,9bS)-3,6,9-trimethyl-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2,7-dione |
| Synonym | Source |
|---|---|
| Achillin | KEGG COMPOUND |
| Citations |
|---|