EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O3 |
| Net Charge | 0 |
| Average Mass | 246.306 |
| Monoisotopic Mass | 246.12559 |
| SMILES | [H][C@]12C(C)=CC(=O)C1=C(C)CC[C@@]1([H])[C@@H](C)C(=O)O[C@]21[H] |
| InChI | InChI=1S/C15H18O3/c1-7-4-5-10-9(3)15(17)18-14(10)13-8(2)6-11(16)12(7)13/h6,9-10,13-14H,4-5H2,1-3H3/t9-,10+,13+,14+/m1/s1 |
| InChIKey | BJPSSVHNEGMBDQ-OAACRXHESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artemisia feddei (ncbitaxon:637478) | - | PubMed (25227949) | |
| Anthemis scrobicularis (ncbitaxon:589792) | aerial part (BTO:0001658) | PubMed (25227949) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. nitric oxide synthase activator Any compound that binds to and activates the enzyme nitric oxide synthase (EC 1.14.13.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| achillin (CHEBI:2425) has role nitric oxide synthase activator (CHEBI:73966) |
| achillin (CHEBI:2425) has role plant metabolite (CHEBI:76924) |
| achillin (CHEBI:2425) is a azulenofuran (CHEBI:39433) |
| achillin (CHEBI:2425) is a sesquiterpene lactone (CHEBI:37667) |
| IUPAC Name |
|---|
| (3R,3aS,9aS,9bS)-3,6,9-trimethyl-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2,7-dione |
| Synonym | Source |
|---|---|
| Achillin | KEGG COMPOUND |
| Citations |
|---|