EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O8 |
| Net Charge | 0 |
| Average Mass | 394.420 |
| Monoisotopic Mass | 394.16277 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]2(C(=O)O)CC[C@H](O)[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C20H26O8/c1-9-7-18-8-19(9,28)5-3-10(18)20(16(26)27)6-4-11(21)17(2,15(24)25)13(20)12(18)14(22)23/h10-13,21,28H,1,3-8H2,2H3,(H,22,23)(H,24,25)(H,26,27)/t10-,11+,12-,13-,17-,18+,19+,20-/m1/s1 |
| InChIKey | YPZCOEDTKIYBEB-ZVBXRXONSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A28 (CHEBI:24241) is a C20-gibberellin (CHEBI:20859) |
| gibberellin A28 (CHEBI:24241) is a tricarboxylic acid (CHEBI:27093) |
| IUPAC Names |
|---|
| (1S,2S,3S,4S,5S,8R,9R,12S)-5,12-dihydroxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4,8-tricarboxylic acid |
| 2β,7α-dihydroxy-1β-methyl-8-methylidene-4aα,4bβ-gibbane-1α,4a,10β-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| gibberellin 28 | ChEBI |
| GA28 | ChEBI |