EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H37N3O4 |
| Net Charge | 0 |
| Average Mass | 383.533 |
| Monoisotopic Mass | 383.27841 |
| SMILES | [H]C(=O)[C@H](CCCC)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(C)=O |
| InChI | InChI=1S/C20H37N3O4/c1-7-8-9-16(12-24)22-19(26)18(11-14(4)5)23-20(27)17(10-13(2)3)21-15(6)25/h12-14,16-18H,7-11H2,1-6H3,(H,21,25)(H,22,26)(H,23,27)/t16-,17-,18-/m0/s1 |
| InChIKey | FMYKJLXRRQTBOR-BZSNNMDCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | cysteine protease inhibitor Any protease inhibitor that restricts the action of a cysteine protease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetylleucyl-leucyl-norleucinal (CHEBI:2423) has role cysteine protease inhibitor (CHEBI:64152) |
| acetylleucyl-leucyl-norleucinal (CHEBI:2423) is a aldehyde (CHEBI:17478) |
| acetylleucyl-leucyl-norleucinal (CHEBI:2423) is a tripeptide (CHEBI:47923) |
| IUPAC Names |
|---|
| (2S)-2-[(2S)-2-acetamido-4-methylpentanamido]-N-[(1S)-1-formylpentyl]-4-methylpentanamide |
| N-acetyl-L-leucyl-N-[(2S)-1-oxohexan-2-yl]-L-leucinamide |
| Synonyms | Source |
|---|---|
| Acetylleucyl-leucyl-norleucinal | KEGG COMPOUND |
| Acetyl-leucyl-leucyl-norleucine-aldehyde | ChemIDplus |
| Ac-Leu-leu-nle-al | ChemIDplus |
| N-acetylleucylleucylnorleucinal | JCBN |
| N-Ac-Leu-leu-norleucinal | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24182910 | Reaxys |
| Reaxys:7656053 | Reaxys |
| CAS:110044-82-1 | ChemIDplus |
| CAS:110044-82-1 | KEGG COMPOUND |
| Citations |
|---|