EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15O9P |
| Net Charge | 0 |
| Average Mass | 262.151 |
| Monoisotopic Mass | 262.04537 |
| SMILES | O=P(O)(O)OC[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H15O9P/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14/h3-11H,1-2H2,(H2,12,13,14)/t3-,4+,5+,6-/m1/s1 |
| InChIKey | GACTWZZMVMUKNG-DPYQTVNSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| galactitol 1-phosphate (CHEBI:28663) has functional parent galactitol (CHEBI:16813) |
| galactitol 1-phosphate (CHEBI:28663) has role Escherichia coli metabolite (CHEBI:76971) |
| galactitol 1-phosphate (CHEBI:28663) is a alditol 1-phosphate (CHEBI:22292) |
| galactitol 1-phosphate (CHEBI:28663) is a galactitol derivative (CHEBI:63432) |
| galactitol 1-phosphate (CHEBI:28663) is a hexitol phosphate (CHEBI:24582) |
| galactitol 1-phosphate (CHEBI:28663) is conjugate acid of galactitol 1-phosphate(2−) (CHEBI:60083) |
| Incoming Relation(s) |
| galactitol 1-phosphate(2−) (CHEBI:60083) is conjugate base of galactitol 1-phosphate (CHEBI:28663) |
| IUPAC Name |
|---|
| D-galactitol 1-(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| 1-O-phosphono-D-galactitol | IUPAC |
| D-Galactitol 1-phosphate | KEGG COMPOUND |
| Galactitol 1-phosphate | KEGG COMPOUND |
| L-Galactitol 6-phosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C06311 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:15664-55-8 | KEGG COMPOUND |