EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14O6 |
| Net Charge | 0 |
| Average Mass | 182.172 |
| Monoisotopic Mass | 182.07904 |
| SMILES | OC[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[h2112h]/1/ |
| InChI | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5+,6- |
| InChIKey | FBPFZTCFMRRESA-GUCUJZIJSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Sporochnus comosus (ncbitaxon:45367) | - | PubMed (21348445) | MeOH and CH2Cl2 extracts of freeze-dried brown algae |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| galactitol (CHEBI:16813) has role Escherichia coli metabolite (CHEBI:76971) |
| galactitol (CHEBI:16813) has role human metabolite (CHEBI:77746) |
| galactitol (CHEBI:16813) has role metabolite (CHEBI:25212) |
| galactitol (CHEBI:16813) has role mouse metabolite (CHEBI:75771) |
| galactitol (CHEBI:16813) is a hexitol (CHEBI:24583) |
| Incoming Relation(s) |
| galactitol 1-phosphate (CHEBI:28663) has functional parent galactitol (CHEBI:16813) |
| galactitol derivative (CHEBI:63432) has functional parent galactitol (CHEBI:16813) |
| α-D-Galf-(1→2)-D-Gal-OH (CHEBI:154940) has functional parent galactitol (CHEBI:16813) |
| α-D-Galp-(1→4)-D-Gal-OH (CHEBI:155712) has functional parent galactitol (CHEBI:16813) |
| α-D-Glcp-(1→6)-D-Gal-OH (CHEBI:152331) has functional parent galactitol (CHEBI:16813) |
| β-(1→6)-galactotetraitol (CHEBI:61768) has functional parent galactitol (CHEBI:16813) |
| β-(1→6)-galactotriitol (CHEBI:61769) has functional parent galactitol (CHEBI:16813) |
| β-D-Gal-(1→4)-β-D-GlcNAc-(1→6)-D-Gal-OH (CHEBI:62662) has functional parent galactitol (CHEBI:16813) |
| β-D-Galp-(1→3)-D-Gal-OH (CHEBI:147570) has functional parent galactitol (CHEBI:16813) |
| β-D-Galp-(1→4)-D-Gal-OH (CHEBI:153130) has functional parent galactitol (CHEBI:16813) |
| β-D-Galp-(1→6)-D-Gal-OH (CHEBI:154769) has functional parent galactitol (CHEBI:16813) |
| β-D-GlcpNAc-(1→3)-D-Gal-OH (CHEBI:147553) has functional parent galactitol (CHEBI:16813) |
| IUPAC Name |
|---|
| meso-galactitol |
| Synonyms | Source |
|---|---|
| (2R,3S,4R,5S)-hexane-1,2,3,4,5,6-hexol | IUPAC |
| D-Dulcitol | ChemIDplus |
| Dulcitol | KEGG COMPOUND |
| Dulcose | KEGG COMPOUND |
| Euonymit | HMDB |
| Galactitol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| galactitol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00001160 | KNApSAcK |
| C01697 | KEGG COMPOUND |
| C01697 | KEGG COMPOUND |
| Galactitol | Wikipedia |
| HMDB0000107 | HMDB |
| Citations |
|---|