EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14O6 |
| Net Charge | 0 |
| Average Mass | 182.172 |
| Monoisotopic Mass | 182.07904 |
| SMILES | OC[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[h2112h]/1/ |
| InChI | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5+,6- |
| InChIKey | FBPFZTCFMRRESA-GUCUJZIJSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sporochnus comosus (ncbitaxon:45367) | - | PubMed (21348445) | MeOH and CH2Cl2 extracts of freeze-dried brown algae |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| galactitol (CHEBI:16813) has role Escherichia coli metabolite (CHEBI:76971) |
| galactitol (CHEBI:16813) has role human metabolite (CHEBI:77746) |
| galactitol (CHEBI:16813) has role metabolite (CHEBI:25212) |
| galactitol (CHEBI:16813) has role mouse metabolite (CHEBI:75771) |
| galactitol (CHEBI:16813) is a hexitol (CHEBI:24583) |
| Incoming Relation(s) |
| galactitol 1-phosphate (CHEBI:28663) has functional parent galactitol (CHEBI:16813) |
| galactitol derivative (CHEBI:63432) has functional parent galactitol (CHEBI:16813) |
| α-D-Galf-(1→2)-D-Gal-OH (CHEBI:154940) has functional parent galactitol (CHEBI:16813) |
| α-D-Galp-(1→4)-D-Gal-OH (CHEBI:155712) has functional parent galactitol (CHEBI:16813) |
| α-D-Glcp-(1→6)-D-Gal-OH (CHEBI:152331) has functional parent galactitol (CHEBI:16813) |
| β-(1→6)-galactotetraitol (CHEBI:61768) has functional parent galactitol (CHEBI:16813) |
| β-(1→6)-galactotriitol (CHEBI:61769) has functional parent galactitol (CHEBI:16813) |
| β-D-Gal-(1→4)-β-D-GlcNAc-(1→6)-D-Gal-OH (CHEBI:62662) has functional parent galactitol (CHEBI:16813) |
| β-D-Galp-(1→3)-D-Gal-OH (CHEBI:147570) has functional parent galactitol (CHEBI:16813) |
| β-D-Galp-(1→4)-D-Gal-OH (CHEBI:153130) has functional parent galactitol (CHEBI:16813) |
| β-D-Galp-(1→6)-D-Gal-OH (CHEBI:154769) has functional parent galactitol (CHEBI:16813) |
| β-D-GlcpNAc-(1→3)-D-Gal-OH (CHEBI:147553) has functional parent galactitol (CHEBI:16813) |
| IUPAC Name |
|---|
| meso-galactitol |
| Synonyms | Source |
|---|---|
| Galactitol | KEGG COMPOUND |
| Dulcitol | KEGG COMPOUND |
| Dulcose | KEGG COMPOUND |
| D-Dulcitol | ChemIDplus |
| D-galactitol | ChEBI |
| (2R,3S,4R,5S)-hexane-1,2,3,4,5,6-hexol | IUPAC |
| UniProt Name | Source |
|---|---|
| galactitol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C01697 | KEGG COMPOUND |
| C01697 | KEGG COMPOUND |
| HMDB0000107 | HMDB |
| Galactitol | Wikipedia |
| C00001160 | KNApSAcK |
| Citations |
|---|