EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO7 |
| Net Charge | 0 |
| Average Mass | 237.208 |
| Monoisotopic Mass | 237.08485 |
| SMILES | [H][C@@](O)([C@]([H])(O)CO)[C@]([H])(O)C(=O)CNCC(=O)O |
| InChI | InChI=1S/C8H15NO7/c10-3-5(12)8(16)7(15)4(11)1-9-2-6(13)14/h5,7-10,12,15-16H,1-3H2,(H,13,14)/t5-,7-,8-/m1/s1 |
| InChIKey | YGUYJMQMTNJNFS-LPBLVHEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fructosylglycine (CHEBI:24108) has role human metabolite (CHEBI:77746) |
| fructosylglycine (CHEBI:24108) is a fructosamine (CHEBI:24103) |
| fructosylglycine (CHEBI:24108) is a glycine derivative (CHEBI:24373) |
| fructosylglycine (CHEBI:24108) is a glyco-amino acid (CHEBI:35258) |
| fructosylglycine (CHEBI:24108) is conjugate acid of fructosylglycinate (CHEBI:66940) |
| Incoming Relation(s) |
| fructosylglycinate (CHEBI:66940) is conjugate base of fructosylglycine (CHEBI:24108) |
| IUPAC Name |
|---|
| N-(1-deoxy-D-fructos-1-yl)glycine |
| Synonyms | Source |
|---|---|
| 1-[(carboxymethyl)amino]-1-deoxy-D-fructose | IUPAC |
| Fructose glycine | ChemIDplus |
| Fructoseglycine | ChemIDplus |
| Fructosyl-glycine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2417529 | Beilstein |
| CAS:4429-05-4 | ChemIDplus |