EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O4 |
| Net Charge | 0 |
| Average Mass | 196.202 |
| Monoisotopic Mass | 196.07356 |
| SMILES | COc1cc(C(C)=O)cc(OC)c1O |
| InChI | InChI=1S/C10H12O4/c1-6(11)7-4-8(13-2)10(12)9(5-7)14-3/h4-5,12H,1-3H3 |
| InChIKey | OJOBTAOGJIWAGB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. anti-asthmatic drug A drug used to treat asthma. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetosyringone (CHEBI:2404) has role anti-asthmatic drug (CHEBI:49167) |
| acetosyringone (CHEBI:2404) has role non-narcotic analgesic (CHEBI:35481) |
| acetosyringone (CHEBI:2404) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| acetosyringone (CHEBI:2404) has role peripheral nervous system drug (CHEBI:49110) |
| acetosyringone (CHEBI:2404) has role plant metabolite (CHEBI:76924) |
| acetosyringone (CHEBI:2404) is a acetophenones (CHEBI:22187) |
| acetosyringone (CHEBI:2404) is a dimethoxybenzene (CHEBI:51681) |
| acetosyringone (CHEBI:2404) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| acetosyringone acetate (CHEBI:86575) has functional parent acetosyringone (CHEBI:2404) |
| IUPAC Name |
|---|
| 1-(4-hydroxy-3,5-dimethoxyphenyl)ethan-1-one |
| Synonyms | Source |
|---|---|
| 4-hydroxy-3,5-dimethoxyacetophenone | ChEBI |
| 4'-Hydroxy-3',5'-dimethoxyacetophenone | ChemIDplus |
| Acetosyringone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| Acetosyringone | Wikipedia |
| C00002686 | KNApSAcK |
| C10664 | KEGG COMPOUND |
| LSM-25648 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1966119 | Reaxys |
| CAS:2478-38-8 | KEGG COMPOUND |
| CAS:2478-38-8 | ChemIDplus |
| Citations |
|---|