EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H29N3O2S |
| Net Charge | 0 |
| Average Mass | 411.571 |
| Monoisotopic Mass | 411.19805 |
| SMILES | CC(=O)c1ccc2c(c1)N(CCCN1CCN(CCO)CC1)c1ccccc1S2 |
| InChI | InChI=1S/C23H29N3O2S/c1-18(28)19-7-8-23-21(17-19)26(20-5-2-3-6-22(20)29-23)10-4-9-24-11-13-25(14-12-24)15-16-27/h2-3,5-8,17,27H,4,9-16H2,1H3 |
| InChIKey | WNTYBHLDCKXEOT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetophenazine (CHEBI:2401) has functional parent 10H-phenothiazine (CHEBI:37931) |
| acetophenazine (CHEBI:2401) has role antipsychotic agent (CHEBI:35476) |
| acetophenazine (CHEBI:2401) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| acetophenazine (CHEBI:2401) is a N-(2-hydroxyethyl)piperazine (CHEBI:46851) |
| acetophenazine (CHEBI:2401) is a N-alkylpiperazine (CHEBI:46845) |
| acetophenazine (CHEBI:2401) is a organic molecular entity (CHEBI:50860) |
| acetophenazine (CHEBI:2401) is a phenothiazines (CHEBI:38093) |
| Incoming Relation(s) |
| acetophenazine dimaleate (CHEBI:2402) has part acetophenazine (CHEBI:2401) |
| IUPAC Name |
|---|
| 1-(10-{3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl}-10H-phenothiazin-2-yl)ethanone |
| INN | Source |
|---|---|
| acetofenazina | WHO MedNet |
| Synonym | Source |
|---|---|
| Acetophenazine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 59 | DrugCentral |
| Acetophenazine | Wikipedia |
| C06807 | KEGG COMPOUND |
| DB01063 | DrugBank |
| HMDB0015196 | HMDB |
| Citations |
|---|